Molecular Formula: C11H24. Element System: C-H. CAS-RN: 61868-97-1. InChI: InChI=1S/C11H24/c1-5-8-11(9-6-2)10(4)7-3/h10-11H,5-9H2,1-4H3.
What is the structure of 3 methyl 4 Ethyloctane?
Octane, 3-ethyl-4-methyl
| PubChem CID | 530223 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C11H24 |
| Synonyms | Octane, 3-ethyl-4-methyl 3-ethyl-4-methyloctane DTXSID10336226 62016-23-3 |
| Molecular Weight | 156.31 |
What is the structure of 3 methyl propane?
3-Methylpentane is a branched alkane with the molecular formula C6H14. It is a structural isomer of hexane composed of a methyl group bonded to the third carbon atom in a pentane chain.
Which is the correct structure for 3 methyl Butanamide?
Butanamide, 3-methyl-N-propyl
| PubChem CID | 528603 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C8H17NO |
| Synonyms | Butanamide, 3-methyl-N-propyl propyl isopropylacetamide SCHEMBL1577892 AKOS003867437 |
| Molecular Weight | 143.23 |
What is the common name of 3 methyl 4 Heptanone?
sec-Butyl Propyl Ketone Synonyms: sec-Butyl Propyl Ketone.
What is the structural formula for 4 Ethyloctane?
C10H22 4-Ethyloctane | C10H22 – PubChem.
What is the structure of Hexanedial?
Adipaldehyde
| PubChem CID | 70620 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C6H10O2 |
| Synonyms | Adipaldehyde Hexanedial 1072-21-5 Adipic dialdehyde UNII-6W2N7U6ZHE More… |
| Molecular Weight | 114.14 |
How many carbons are in 3-methylpentane?
3-Methylpentane is a branched alkane with the molecular formula C6H14. It is a structural isomer of hexane composed of a methyl group bonded to the third carbon atom in a pentane chain….3-Methylpentane.
| Names | |
|---|---|
| ChemSpider | 7010 |
| ECHA InfoCard | 100.002.257 |
| EC Number | 202-481-4 |
| MeSH | 3-methylpentane |